jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

Answer Quick!!!!!!!!!!!!!!!!!!!(What idea did George Washington introduce as president of the United States? OA The US president's first two years should be the

A pair of dice is rolled. What is the probability that the sum of the two dice will less than 4 given that the first die rolled is a 2?

Write an equation of the line that passes through the point (-6, -5) with slope 6. A. y +5= -6(x+6) B.y+6= -6(x+5) C. y+6=6(x+5) D.y+5= 6(x+6)

What is chemical compound

Please help. I’ll mark you as brainliest if correct!

In which particle model are the red and blue particles MOST LIKELY to bump into each other? PLEASE HELP WILL MARK BRAINLIEST!!

Define the word informal

Devi’s mother is three times as old as Devi. Five years ago, Devi’s mother was four times as old as Devi was then. Find their present ages

The total mass of eight identicalbuilding blocks is 31.52 kg. Find themass of 1 block.

HELP ASAP. BRAINLIST IF YOU ANSWERED IT RIGHT Which of the following theorems verifies that NPO-XYZ